C24H26O5 — CID 91728340
5-O-hex-4-yn-3-yl 1-O-[(3-phenoxyphenyl)methyl] pentanedioate (PubChem CID 91728340) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 5-O-hex-4-yn-3-yl 1-O-[(3-phenoxyphenyl)methyl] pentanedioate.
| Compound Name | 5-O-hex-4-yn-3-yl 1-O-[(3-phenoxyphenyl)methyl] pentanedioate |
|---|---|
| PubChem CID | 91728340 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 5-O-hex-4-yn-3-yl 1-O-[(3-phenoxyphenyl)methyl] pentanedioate |
| SMILES | CC#CC(CC)OC(=O)CCCC(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H26O5/c1-3-10-20(4-2)29-24(26)16-9-15-23(25)27-18-19-11-8-14-22(17-19)28-21-12-6-5-7-13-21/h5-8,11-14,17,20H,4,9,15-16,18H2,1-2H3 |
| InChIKey | SBYGSDUIILINPF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|