C24H30O5 — CID 91728355
5-O-(2-methylpentan-3-yl) 1-O-[(3-phenoxyphenyl)methyl] pentanedioate (PubChem CID 91728355) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 5-O-(2-methylpentan-3-yl) 1-O-[(3-phenoxyphenyl)methyl] pentanedioate.
| Compound Name | 5-O-(2-methylpentan-3-yl) 1-O-[(3-phenoxyphenyl)methyl] pentanedioate |
|---|---|
| PubChem CID | 91728355 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 5-O-(2-methylpentan-3-yl) 1-O-[(3-phenoxyphenyl)methyl] pentanedioate |
| SMILES | CCC(OC(=O)CCCC(=O)OCc1cccc(Oc2ccccc2)c1)C(C)C |
| InChI | InChI=1S/C24H30O5/c1-4-22(18(2)3)29-24(26)15-9-14-23(25)27-17-19-10-8-13-21(16-19)28-20-11-6-5-7-12-20/h5-8,10-13,16,18,22H,4,9,14-15,17H2,1-3H3 |
| InChIKey | SESUWORTJNCCAT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |