About (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate
(3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate (PubChem CID 10813628) has the molecular formula C24H23BrO4
and a molecular weight of 455.35 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate.
Molecular Properties
| Compound Name | (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate |
| PubChem CID | 10813628 |
| Molecular Formula | C24H23BrO4 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate |
| SMILES | CC(C)C(Oc1ccc(Br)cc1)C(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H23BrO4/c1-17(2)23(29-21-13-11-19(25)12-14-21)24(26)27-16-18-7-6-10-22(15-18)28-20-8-4-3-5-9-20/h3-15,17,23H,16H2,1-2H3 |
| InChIKey | VWZUXVUKJAEWFQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate?
The IUPAC name of (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate (CID 10813628) is (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate.
What is the SMILES notation for (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate?
The canonical SMILES for (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate is CC(C)C(Oc1ccc(Br)cc1)C(=O)OCc1cccc(Oc2ccccc2)c1.
What is the InChIKey of (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate?
The InChIKey is VWZUXVUKJAEWFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23BrO4/c1-17(2)23(29-21-13-11-19(25)12-14-21)24(26)27-16-18-7-6-10-22(15-18)28-20-8-4-3-5-9-20/h3-15,17,23H,16H2,1-2H3.
What are the key properties of (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate?
(3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate has a molecular weight of 455.35 g/mol, XLogP of 6.39, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenoxyphenyl)methyl 2-(4-bromophenoxy)-3-methylbutanoate is sourced from PubChem (CID 10813628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).