About (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate
(3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate (PubChem CID 21125417) has the molecular formula C25H27NO3
and a molecular weight of 389.50 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate |
| PubChem CID | 21125417 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(C(=O)OCc1cccc(Oc2ccccc2)c1)C(C)c1ccccc1 |
| InChI | InChI=1S/C25H27NO3/c1-19(2)26(20(3)22-12-6-4-7-13-22)25(27)28-18-21-11-10-16-24(17-21)29-23-14-8-5-9-15-23/h4-17,19-20H,18H2,1-3H3 |
| InChIKey | QOUYPOZNLGFNAO-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate?
The IUPAC name of (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate (CID 21125417) is (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate.
What is the SMILES notation for (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate?
The canonical SMILES for (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate is CC(C)N(C(=O)OCc1cccc(Oc2ccccc2)c1)C(C)c1ccccc1.
What is the InChIKey of (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate?
The InChIKey is QOUYPOZNLGFNAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27NO3/c1-19(2)26(20(3)22-12-6-4-7-13-22)25(27)28-18-21-11-10-16-24(17-21)29-23-14-8-5-9-15-23/h4-17,19-20H,18H2,1-3H3.
What are the key properties of (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate?
(3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate has a molecular weight of 389.50 g/mol, XLogP of 6.59, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenoxyphenyl)methyl N-(1-phenylethyl)-N-propan-2-ylcarbamate is sourced from PubChem (CID 21125417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).