About (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate
(3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate (PubChem CID 12895330) has the molecular formula C26H25FO3
and a molecular weight of 404.48 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate.
Molecular Properties
| Compound Name | (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate |
| PubChem CID | 12895330 |
| Molecular Formula | C26H25FO3 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate |
| SMILES | CC(C)C(/C=C/c1cccc(F)c1)C(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H25FO3/c1-19(2)25(15-14-20-8-6-10-22(27)16-20)26(28)29-18-21-9-7-13-24(17-21)30-23-11-4-3-5-12-23/h3-17,19,25H,18H2,1-2H3/b15-14+ |
| InChIKey | BUQBASJTYQCJSC-CCEZHUSRSA-N |
| XLogP | 6.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate?
The IUPAC name of (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate (CID 12895330) is (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate.
What is the SMILES notation for (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate?
The canonical SMILES for (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate is CC(C)C(/C=C/c1cccc(F)c1)C(=O)OCc1cccc(Oc2ccccc2)c1.
What is the InChIKey of (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate?
The InChIKey is BUQBASJTYQCJSC-CCEZHUSRSA-N. The full InChI is InChI=1S/C26H25FO3/c1-19(2)25(15-14-20-8-6-10-22(27)16-20)26(28)29-18-21-9-7-13-24(17-21)30-23-11-4-3-5-12-23/h3-17,19,25H,18H2,1-2H3/b15-14+.
What are the key properties of (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate?
(3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate has a molecular weight of 404.48 g/mol, XLogP of 6.65, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenoxyphenyl)methyl (E)-4-(3-fluorophenyl)-2-propan-2-ylbut-3-enoate is sourced from PubChem (CID 12895330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).