C23H30O3 — CID 154979450
(3-phenoxyphenyl)methyl 2-ethyl-4,4-dimethylhexanoate (PubChem CID 154979450) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 2-ethyl-4,4-dimethylhexanoate.
| Compound Name | (3-phenoxyphenyl)methyl 2-ethyl-4,4-dimethylhexanoate |
|---|---|
| PubChem CID | 154979450 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (3-phenoxyphenyl)methyl 2-ethyl-4,4-dimethylhexanoate |
| SMILES | CCC(CC(C)(C)CC)C(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H30O3/c1-5-19(16-23(3,4)6-2)22(24)25-17-18-11-10-14-21(15-18)26-20-12-8-7-9-13-20/h7-15,19H,5-6,16-17H2,1-4H3 |
| InChIKey | YXKCYNGOVRGDGF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |