C19H12Cl2F6O3 — CID 13044731
(3-phenoxyphenyl)methyl 2,3-dichloro-2,3-bis(trifluoromethyl)cyclopropane-1-carboxylate (PubChem CID 13044731) has the molecular formula C19H12Cl2F6O3 and a molecular weight of 473.20 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 2,3-dichloro-2,3-bis(trifluoromethyl)cyclopropane-1-carboxylate.
| Compound Name | (3-phenoxyphenyl)methyl 2,3-dichloro-2,3-bis(trifluoromethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 13044731 |
| Molecular Formula | C19H12Cl2F6O3 |
| Molecular Weight | 473.20 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | (3-phenoxyphenyl)methyl 2,3-dichloro-2,3-bis(trifluoromethyl)cyclopropane-1-carboxylate |
| SMILES | O=C(OCc1cccc(Oc2ccccc2)c1)C1C(Cl)(C(F)(F)F)C1(Cl)C(F)(F)F |
| InChI | InChI=1S/C19H12Cl2F6O3/c20-16(18(22,23)24)14(17(16,21)19(25,26)27)15(28)29-10-11-5-4-8-13(9-11)30-12-6-2-1-3-7-12/h1-9,14H,10H2 |
| InChIKey | CATOGONQEUBKLJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.20 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|