C26H30O4S — CID 57018271
trans-(3-phenoxyphenyl)methyl (1R,3S)-3-(3-tert-butylsulfanyl-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 57018271) has the molecular formula C26H30O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is trans-(3-phenoxyphenyl)methyl (1R,3S)-3-(3-tert-butylsulfanyl-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(3-phenoxyphenyl)methyl (1R,3S)-3-(3-tert-butylsulfanyl-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57018271 |
| Molecular Formula | C26H30O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | trans-(3-phenoxyphenyl)methyl (1R,3S)-3-(3-tert-butylsulfanyl-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC(C)(C)SC(=O)C=C[C@H]1[C@@H](C(=O)OCc2cccc(Oc3ccccc3)c2)C1(C)C |
| InChI | InChI=1S/C26H30O4S/c1-25(2,3)31-22(27)15-14-21-23(26(21,4)5)24(28)29-17-18-10-9-13-20(16-18)30-19-11-7-6-8-12-19/h6-16,21,23H,17H2,1-5H3/t21-,23-/m0/s1 |
| InChIKey | GKZNBYXKAITDMX-GMAHTHKFSA-N |
| XLogP | 6.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|