C24H27NO4 — CID 88742789
cis-(3-phenoxyphenyl)methyl (1R,3R)-3-(cyclopropylmethoxyiminomethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88742789) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is cis-(3-phenoxyphenyl)methyl (1R,3R)-3-(cyclopropylmethoxyiminomethyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-(3-phenoxyphenyl)methyl (1R,3R)-3-(cyclopropylmethoxyiminomethyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88742789 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | cis-(3-phenoxyphenyl)methyl (1R,3R)-3-(cyclopropylmethoxyiminomethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C=NOCC2CC2)[C@H]1C(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H27NO4/c1-24(2)21(14-25-28-16-17-11-12-17)22(24)23(26)27-15-18-7-6-10-20(13-18)29-19-8-4-3-5-9-19/h3-10,13-14,17,21-22H,11-12,15-16H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | PFVHYZPMYZPQDI-YADHBBJMSA-N |
| XLogP | 5.21 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|