C24H27NO4 — CID 173438967
(1R)-3-(cyclopropylmethoxyiminomethyl)-2,2-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylic acid (PubChem CID 173438967) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is (1R)-3-(cyclopropylmethoxyiminomethyl)-2,2-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | (1R)-3-(cyclopropylmethoxyiminomethyl)-2,2-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 173438967 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (1R)-3-(cyclopropylmethoxyiminomethyl)-2,2-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C=NOCC2CC2)[C@@]1(Cc1cccc(Oc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C24H27NO4/c1-23(2)21(15-25-28-16-17-11-12-17)24(23,22(26)27)14-18-7-6-10-20(13-18)29-19-8-4-3-5-9-19/h3-10,13,15,17,21H,11-12,14,16H2,1-2H3,(H,26,27)/t21?,24-/m0/s1 |
| InChIKey | BDWLNYJJLJIANV-FHZUCYEKSA-N |
| XLogP | 5.16 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|