C24H26FNO4 — CID 88710022
(4-fluoro-3-phenoxyphenyl)methyl 3-[(E)-cyclopropylmethoxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88710022) has the molecular formula C24H26FNO4 and a molecular weight of 411.47 g/mol. Its IUPAC name is (4-fluoro-3-phenoxyphenyl)methyl 3-[(E)-cyclopropylmethoxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (4-fluoro-3-phenoxyphenyl)methyl 3-[(E)-cyclopropylmethoxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88710022 |
| Molecular Formula | C24H26FNO4 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (4-fluoro-3-phenoxyphenyl)methyl 3-[(E)-cyclopropylmethoxyiminomethyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(/C=N/OCC2CC2)C1C(=O)OCc1ccc(F)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H26FNO4/c1-24(2)19(13-26-29-15-16-8-9-16)22(24)23(27)28-14-17-10-11-20(25)21(12-17)30-18-6-4-3-5-7-18/h3-7,10-13,16,19,22H,8-9,14-15H2,1-2H3/b26-13+ |
| InChIKey | GSJYWONZRLHETP-LGJNPRDNSA-N |
| XLogP | 5.35 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|