C25H31NO3S — CID 54112693
cis-(3-phenylsulfanylphenyl)methyl (1R,3R)-3-(2,2-dimethylpropoxyiminomethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54112693) has the molecular formula C25H31NO3S and a molecular weight of 425.59 g/mol. Its IUPAC name is cis-(3-phenylsulfanylphenyl)methyl (1R,3R)-3-(2,2-dimethylpropoxyiminomethyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-(3-phenylsulfanylphenyl)methyl (1R,3R)-3-(2,2-dimethylpropoxyiminomethyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54112693 |
| Molecular Formula | C25H31NO3S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | cis-(3-phenylsulfanylphenyl)methyl (1R,3R)-3-(2,2-dimethylpropoxyiminomethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC(C)(C)CON=C[C@@H]1[C@@H](C(=O)OCc2cccc(Sc3ccccc3)c2)C1(C)C |
| InChI | InChI=1S/C25H31NO3S/c1-24(2,3)17-29-26-15-21-22(25(21,4)5)23(27)28-16-18-10-9-13-20(14-18)30-19-11-7-6-8-12-19/h6-15,21-22H,16-17H2,1-5H3/t21-,22+/m1/s1 |
| InChIKey | NIEWOUXLKHCKLS-YADHBBJMSA-N |
| XLogP | 6.20 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|