About (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate
(3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 12944761) has the molecular formula C22H22Cl2O2
and a molecular weight of 389.32 g/mol. Its IUPAC name is (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| PubChem CID | 12944761 |
| Molecular Formula | C22H22Cl2O2 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OCc1cccc(Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H22Cl2O2/c1-22(2)18(13-19(23)24)20(22)21(25)26-14-17-10-6-9-16(12-17)11-15-7-4-3-5-8-15/h3-10,12-13,18,20H,11,14H2,1-2H3 |
| InChIKey | LDADRFOJLNGVRZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CID 12944761) is (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate is CC1(C)C(C=C(Cl)Cl)C1C(=O)OCc1cccc(Cc2ccccc2)c1.
What is the InChIKey of (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is LDADRFOJLNGVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22Cl2O2/c1-22(2)18(13-19(23)24)20(22)21(25)26-14-17-10-6-9-16(12-17)11-15-7-4-3-5-8-15/h3-10,12-13,18,20H,11,14H2,1-2H3.
What are the key properties of (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate?
(3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 389.32 g/mol, XLogP of 5.91, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 12944761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).