C23H20Cl2F4O2 — CID 88776843
trans-(3-phenylphenyl)methyl (1R,3R)-3-[(E)-2,4-dichloro-3,3,4,4-tetrafluorobut-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88776843) has the molecular formula C23H20Cl2F4O2 and a molecular weight of 475.31 g/mol. Its IUPAC name is trans-(3-phenylphenyl)methyl (1R,3R)-3-[(E)-2,4-dichloro-3,3,4,4-tetrafluorobut-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(3-phenylphenyl)methyl (1R,3R)-3-[(E)-2,4-dichloro-3,3,4,4-tetrafluorobut-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88776843 |
| Molecular Formula | C23H20Cl2F4O2 |
| Molecular Weight | 475.31 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | trans-(3-phenylphenyl)methyl (1R,3R)-3-[(E)-2,4-dichloro-3,3,4,4-tetrafluorobut-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCc2cccc(-c3ccccc3)c2)[C@@H]1/C=C(/Cl)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C23H20Cl2F4O2/c1-21(2)17(12-18(24)22(26,27)23(25,28)29)19(21)20(30)31-13-14-7-6-10-16(11-14)15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3/b18-12+/t17-,19-/m0/s1 |
| InChIKey | WCNKKQNTTYWWJW-GDEFMPCUSA-N |
| XLogP | 7.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.31 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|