C23H26NO3- — CID 57346387
cis-(1R,3S)-3-[(2S)-3,3-dimethylaziridin-2-yl]-2,2-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylate (PubChem CID 57346387) has the molecular formula C23H26NO3- and a molecular weight of 364.47 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(2S)-3,3-dimethylaziridin-2-yl]-2,2-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylate.
| Compound Name | cis-(1R,3S)-3-[(2S)-3,3-dimethylaziridin-2-yl]-2,2-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57346387 |
| Molecular Formula | C23H26NO3- |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | cis-(1R,3S)-3-[(2S)-3,3-dimethylaziridin-2-yl]-2,2-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylate |
| SMILES | CC1(C)N[C@H]1[C@H]1C(C)(C)[C@]1(Cc1cccc(Oc2ccccc2)c1)C(=O)[O-] |
| InChI | InChI=1S/C23H27NO3/c1-21(2)18(19-22(3,4)24-19)23(21,20(25)26)14-15-9-8-12-17(13-15)27-16-10-6-5-7-11-16/h5-13,18-19,24H,14H2,1-4H3,(H,25,26)/p-1/t18-,19-,23-/m0/s1 |
| InChIKey | VVWDLQUQCKYKHY-YDHSSHFGSA-M |
| XLogP | 3.16 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|