C32H28N3O5- — CID 71317630
2-cyano-2-[1-(1,3-dioxoisoindol-2-yl)-3,3-dimethylaziridin-2-yl]-3,3-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylate (PubChem CID 71317630) has the molecular formula C32H28N3O5- and a molecular weight of 534.59 g/mol. Its IUPAC name is 2-cyano-2-[1-(1,3-dioxoisoindol-2-yl)-3,3-dimethylaziridin-2-yl]-3,3-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylate.
| Compound Name | 2-cyano-2-[1-(1,3-dioxoisoindol-2-yl)-3,3-dimethylaziridin-2-yl]-3,3-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71317630 |
| Molecular Formula | C32H28N3O5- |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 2-cyano-2-[1-(1,3-dioxoisoindol-2-yl)-3,3-dimethylaziridin-2-yl]-3,3-dimethyl-1-[(3-phenoxyphenyl)methyl]cyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C2(C#N)C(C)(C)C2(Cc2cccc(Oc3ccccc3)c2)C(=O)[O-])N1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H29N3O5/c1-29(2)27(35(29)34-25(36)23-15-8-9-16-24(23)26(34)37)32(19-33)30(3,4)31(32,28(38)39)18-20-11-10-14-22(17-20)40-21-12-6-5-7-13-21/h5-17,27H,18H2,1-4H3,(H,38,39)/p-1 |
| InChIKey | INRSBMYQKCGAOR-UHFFFAOYSA-M |
| XLogP | 3.98 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|