C20H13NO3 — CID 3091542
2-(3-phenoxyphenyl)isoindole-1,3-dione (PubChem CID 3091542) has the molecular formula C20H13NO3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-(3-phenoxyphenyl)isoindole-1,3-dione.
| Compound Name | 2-(3-phenoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 3091542 |
| Molecular Formula | C20H13NO3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-(3-phenoxyphenyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H13NO3/c22-19-17-11-4-5-12-18(17)20(23)21(19)14-7-6-10-16(13-14)24-15-8-2-1-3-9-15/h1-13H |
| InChIKey | OJVRXCFUGGNQQM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|