C44H24N2O5 — CID 101052172
2-[4-[3-[1,3-dioxo-4-(2-phenylethynyl)isoindol-2-yl]phenoxy]phenyl]-4-(2-phenylethynyl)isoindole-1,3-dione (PubChem CID 101052172) has the molecular formula C44H24N2O5 and a molecular weight of 660.69 g/mol. Its IUPAC name is 2-[4-[3-[1,3-dioxo-4-(2-phenylethynyl)isoindol-2-yl]phenoxy]phenyl]-4-(2-phenylethynyl)isoindole-1,3-dione.
| Compound Name | 2-[4-[3-[1,3-dioxo-4-(2-phenylethynyl)isoindol-2-yl]phenoxy]phenyl]-4-(2-phenylethynyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 101052172 |
| Molecular Formula | C44H24N2O5 |
| Molecular Weight | 660.69 g/mol |
| Exact Mass | 660.17 |
| IUPAC Name | 2-[4-[3-[1,3-dioxo-4-(2-phenylethynyl)isoindol-2-yl]phenoxy]phenyl]-4-(2-phenylethynyl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(C#Cc3ccccc3)c2C(=O)N1c1ccc(Oc2cccc(N3C(=O)c4cccc(C#Cc5ccccc5)c4C3=O)c2)cc1 |
| InChI | InChI=1S/C44H24N2O5/c47-41-37-18-7-14-31(22-20-29-10-3-1-4-11-29)39(37)43(49)45(41)33-24-26-35(27-25-33)51-36-17-9-16-34(28-36)46-42(48)38-19-8-15-32(40(38)44(46)50)23-21-30-12-5-2-6-13-30/h1-19,24-28H |
| InChIKey | LPFKCCVMOUQSDP-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.69 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|