C27H17NO3 — CID 101190130
4-[2-(4-methoxynaphthalen-1-yl)ethynyl]-2-phenylisoindole-1,3-dione (PubChem CID 101190130) has the molecular formula C27H17NO3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 4-[2-(4-methoxynaphthalen-1-yl)ethynyl]-2-phenylisoindole-1,3-dione.
| Compound Name | 4-[2-(4-methoxynaphthalen-1-yl)ethynyl]-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 101190130 |
| Molecular Formula | C27H17NO3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-[2-(4-methoxynaphthalen-1-yl)ethynyl]-2-phenylisoindole-1,3-dione |
| SMILES | COc1ccc(C#Cc2cccc3c2C(=O)N(c2ccccc2)C3=O)c2ccccc12 |
| InChI | InChI=1S/C27H17NO3/c1-31-24-17-16-18(21-11-5-6-12-22(21)24)14-15-19-8-7-13-23-25(19)27(30)28(26(23)29)20-9-3-2-4-10-20/h2-13,16-17H,1H3 |
| InChIKey | QGSXQLJPBYEMDE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|