C18H17NO5 — CID 748487
2-(4-ethoxyphenyl)-4,5-dimethoxyisoindole-1,3-dione (PubChem CID 748487) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-4,5-dimethoxyisoindole-1,3-dione.
| Compound Name | 2-(4-ethoxyphenyl)-4,5-dimethoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 748487 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-(4-ethoxyphenyl)-4,5-dimethoxyisoindole-1,3-dione |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(OC)c(OC)c3C2=O)cc1 |
| InChI | InChI=1S/C18H17NO5/c1-4-24-12-7-5-11(6-8-12)19-17(20)13-9-10-14(22-2)16(23-3)15(13)18(19)21/h5-10H,4H2,1-3H3 |
| InChIKey | KZQMXMJTJCTSMT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|