C24H18N2O4S — CID 1301908
4,5-dimethoxy-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 1301908) has the molecular formula C24H18N2O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 4,5-dimethoxy-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1301908 |
| Molecular Formula | C24H18N2O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 4,5-dimethoxy-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | COc1ccc2c(c1OC)C(=O)N(c1ccc(-c3nc4ccc(C)cc4s3)cc1)C2=O |
| InChI | InChI=1S/C24H18N2O4S/c1-13-4-10-17-19(12-13)31-22(25-17)14-5-7-15(8-6-14)26-23(27)16-9-11-18(29-2)21(30-3)20(16)24(26)28/h4-12H,1-3H3 |
| InChIKey | QPNYECNXAAFZLB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|