C17H17NO3S — CID 50849900
6-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole (PubChem CID 50849900) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 6-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole.
| Compound Name | 6-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 50849900 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 6-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole |
| SMILES | COc1cc(-c2nc3ccc(C)cc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17NO3S/c1-10-5-6-12-15(7-10)22-17(18-12)11-8-13(19-2)16(21-4)14(9-11)20-3/h5-9H,1-4H3 |
| InChIKey | MORVUWJEEGBLBG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |