C24H18F3NOS — CID 58342050
2-[4-[(E)-2-[4-methoxy-3-(trifluoromethyl)phenyl]ethenyl]phenyl]-6-methyl-1,3-benzothiazole (PubChem CID 58342050) has the molecular formula C24H18F3NOS and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-methoxy-3-(trifluoromethyl)phenyl]ethenyl]phenyl]-6-methyl-1,3-benzothiazole.
| Compound Name | 2-[4-[(E)-2-[4-methoxy-3-(trifluoromethyl)phenyl]ethenyl]phenyl]-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 58342050 |
| Molecular Formula | C24H18F3NOS |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-[4-[(E)-2-[4-methoxy-3-(trifluoromethyl)phenyl]ethenyl]phenyl]-6-methyl-1,3-benzothiazole |
| SMILES | COc1ccc(/C=C/c2ccc(-c3nc4ccc(C)cc4s3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H18F3NOS/c1-15-3-11-20-22(13-15)30-23(28-20)18-9-6-16(7-10-18)4-5-17-8-12-21(29-2)19(14-17)24(25,26)27/h3-14H,1-2H3/b5-4+ |
| InChIKey | NGPBQZQTCIEWFV-SNAWJCMRSA-N |
| XLogP | 7.47 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|