C25H18F3NOS — CID 58342169
1,1,1-trifluoro-3-[4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenyl]propan-2-one (PubChem CID 58342169) has the molecular formula C25H18F3NOS and a molecular weight of 437.49 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenyl]propan-2-one.
| Compound Name | 1,1,1-trifluoro-3-[4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 58342169 |
| Molecular Formula | C25H18F3NOS |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1,1,1-trifluoro-3-[4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenyl]propan-2-one |
| SMILES | Cc1ccc2nc(-c3ccc(/C=C/c4ccc(CC(=O)C(F)(F)F)cc4)cc3)sc2c1 |
| InChI | InChI=1S/C25H18F3NOS/c1-16-2-13-21-22(14-16)31-24(29-21)20-11-9-18(10-12-20)4-3-17-5-7-19(8-6-17)15-23(30)25(26,27)28/h2-14H,15H2,1H3/b4-3+ |
| InChIKey | ZISGLFYJNANJRZ-ONEGZZNKSA-N |
| XLogP | 7.12 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|