C22H17NOS — CID 67238148
3-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenol (PubChem CID 67238148) has the molecular formula C22H17NOS and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenol.
| Compound Name | 3-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 67238148 |
| Molecular Formula | C22H17NOS |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenol |
| SMILES | Cc1ccc2nc(-c3ccc(C=Cc4cccc(O)c4)cc3)sc2c1 |
| InChI | InChI=1S/C22H17NOS/c1-15-5-12-20-21(13-15)25-22(23-20)18-10-8-16(9-11-18)6-7-17-3-2-4-19(24)14-17/h2-14,24H,1H3 |
| InChIKey | ZRSIGAMNZUBFBM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|