C14H11NO2S — CID 136813339
2-(6-methyl-1,3-benzothiazol-2-yl)benzene-1,3-diol (PubChem CID 136813339) has the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-(6-methyl-1,3-benzothiazol-2-yl)benzene-1,3-diol.
| Compound Name | 2-(6-methyl-1,3-benzothiazol-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 136813339 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-(6-methyl-1,3-benzothiazol-2-yl)benzene-1,3-diol |
| SMILES | Cc1ccc2nc(-c3c(O)cccc3O)sc2c1 |
| InChI | InChI=1S/C14H11NO2S/c1-8-5-6-9-12(7-8)18-14(15-9)13-10(16)3-2-4-11(13)17/h2-7,16-17H,1H3 |
| InChIKey | KESUETZIGFGQBA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |