C8H6INS — CID 90078540
2-iodo-6-methyl-1,3-benzothiazole (PubChem CID 90078540) has the molecular formula C8H6INS and a molecular weight of 275.11 g/mol. Its IUPAC name is 2-iodo-6-methyl-1,3-benzothiazole.
| Compound Name | 2-iodo-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 90078540 |
| Molecular Formula | C8H6INS |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.93 |
| IUPAC Name | 2-iodo-6-methyl-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(I)sc2c1 |
| InChI | InChI=1S/C8H6INS/c1-5-2-3-6-7(4-5)11-8(9)10-6/h2-4H,1H3 |
| InChIKey | ZJBQXIOEBUQGJN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|