C7H3ClINS — CID 18967167
6-chloro-2-iodo-1,3-benzothiazole (PubChem CID 18967167) has the molecular formula C7H3ClINS and a molecular weight of 295.53 g/mol. Its IUPAC name is 6-chloro-2-iodo-1,3-benzothiazole.
| Compound Name | 6-chloro-2-iodo-1,3-benzothiazole |
|---|---|
| PubChem CID | 18967167 |
| Molecular Formula | C7H3ClINS |
| Molecular Weight | 295.53 g/mol |
| Exact Mass | 294.87 |
| IUPAC Name | 6-chloro-2-iodo-1,3-benzothiazole |
| SMILES | Clc1ccc2nc(I)sc2c1 |
| InChI | InChI=1S/C7H3ClINS/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H |
| InChIKey | LKNMRUVYQUJWRD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|