C13H8Cl2N2S — CID 5044430
6-chloro-N-(4-chlorophenyl)-1,3-benzothiazol-2-amine (PubChem CID 5044430) has the molecular formula C13H8Cl2N2S and a molecular weight of 295.19 g/mol. Its IUPAC name is 6-chloro-N-(4-chlorophenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-(4-chlorophenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 5044430 |
| Molecular Formula | C13H8Cl2N2S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 6-chloro-N-(4-chlorophenyl)-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc(Nc2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C13H8Cl2N2S/c14-8-1-4-10(5-2-8)16-13-17-11-6-3-9(15)7-12(11)18-13/h1-7H,(H,16,17) |
| InChIKey | GBAKYKWLMZDSRW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |