C8H7ClN2S — CID 10774358
6-chloro-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 10774358) has the molecular formula C8H7ClN2S and a molecular weight of 198.68 g/mol. Its IUPAC name is 6-chloro-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 10774358 |
| Molecular Formula | C8H7ClN2S |
| Molecular Weight | 198.68 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 6-chloro-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C8H7ClN2S/c1-10-8-11-6-3-2-5(9)4-7(6)12-8/h2-4H,1H3,(H,10,11) |
| InChIKey | LZCBQCKLQRWOJK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |