C11H11ClN2S — CID 79525447
6-chloro-N-cyclobutyl-1,3-benzothiazol-2-amine (PubChem CID 79525447) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 6-chloro-N-cyclobutyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-cyclobutyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79525447 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 6-chloro-N-cyclobutyl-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc2nc(NC3CCC3)sc2c1 |
| InChI | InChI=1S/C11H11ClN2S/c12-7-4-5-9-10(6-7)15-11(14-9)13-8-2-1-3-8/h4-6,8H,1-3H2,(H,13,14) |
| InChIKey | IKQYBVOWKVXAIT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |