C13H15ClN2S — CID 79528936
6-chloro-N-(cyclopentylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 79528936) has the molecular formula C13H15ClN2S and a molecular weight of 266.80 g/mol. Its IUPAC name is 6-chloro-N-(cyclopentylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-(cyclopentylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79528936 |
| Molecular Formula | C13H15ClN2S |
| Molecular Weight | 266.80 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 6-chloro-N-(cyclopentylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc2nc(NCC3CCCC3)sc2c1 |
| InChI | InChI=1S/C13H15ClN2S/c14-10-5-6-11-12(7-10)17-13(16-11)15-8-9-3-1-2-4-9/h5-7,9H,1-4,8H2,(H,15,16) |
| InChIKey | AAXCRPMHELGQDV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |