C13H16ClN3S — CID 21241580
6-chloro-N-(piperidin-4-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 21241580) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is 6-chloro-N-(piperidin-4-ylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-(piperidin-4-ylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 21241580 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 6-chloro-N-(piperidin-4-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc2nc(NCC3CCNCC3)sc2c1 |
| InChI | InChI=1S/C13H16ClN3S/c14-10-1-2-11-12(7-10)18-13(17-11)16-8-9-3-5-15-6-4-9/h1-2,7,9,15H,3-6,8H2,(H,16,17) |
| InChIKey | XBJGHGDUJLURCP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |