C15H17ClN2S — CID 79525165
6-chloro-N-(2,2-dicyclopropylethyl)-1,3-benzothiazol-2-amine (PubChem CID 79525165) has the molecular formula C15H17ClN2S and a molecular weight of 292.83 g/mol. Its IUPAC name is 6-chloro-N-(2,2-dicyclopropylethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-(2,2-dicyclopropylethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79525165 |
| Molecular Formula | C15H17ClN2S |
| Molecular Weight | 292.83 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 6-chloro-N-(2,2-dicyclopropylethyl)-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc2nc(NCC(C3CC3)C3CC3)sc2c1 |
| InChI | InChI=1S/C15H17ClN2S/c16-11-5-6-13-14(7-11)19-15(18-13)17-8-12(9-1-2-9)10-3-4-10/h5-7,9-10,12H,1-4,8H2,(H,17,18) |
| InChIKey | AZMZQLMWUDODKL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |