C13H7BrCl2N2S — CID 79532935
6-bromo-N-(3,5-dichlorophenyl)-1,3-benzothiazol-2-amine (PubChem CID 79532935) has the molecular formula C13H7BrCl2N2S and a molecular weight of 374.09 g/mol. Its IUPAC name is 6-bromo-N-(3,5-dichlorophenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N-(3,5-dichlorophenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79532935 |
| Molecular Formula | C13H7BrCl2N2S |
| Molecular Weight | 374.09 g/mol |
| Exact Mass | 371.89 |
| IUPAC Name | 6-bromo-N-(3,5-dichlorophenyl)-1,3-benzothiazol-2-amine |
| SMILES | Clc1cc(Cl)cc(Nc2nc3ccc(Br)cc3s2)c1 |
| InChI | InChI=1S/C13H7BrCl2N2S/c14-7-1-2-11-12(3-7)19-13(18-11)17-10-5-8(15)4-9(16)6-10/h1-6H,(H,17,18) |
| InChIKey | CQNWBSYHWGEFEA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.09 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |