C14H11BrN2S2 — CID 79534156
6-bromo-N-(3-methylsulfanylphenyl)-1,3-benzothiazol-2-amine (PubChem CID 79534156) has the molecular formula C14H11BrN2S2 and a molecular weight of 351.29 g/mol. Its IUPAC name is 6-bromo-N-(3-methylsulfanylphenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N-(3-methylsulfanylphenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79534156 |
| Molecular Formula | C14H11BrN2S2 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 6-bromo-N-(3-methylsulfanylphenyl)-1,3-benzothiazol-2-amine |
| SMILES | CSc1cccc(Nc2nc3ccc(Br)cc3s2)c1 |
| InChI | InChI=1S/C14H11BrN2S2/c1-18-11-4-2-3-10(8-11)16-14-17-12-6-5-9(15)7-13(12)19-14/h2-8H,1H3,(H,16,17) |
| InChIKey | DRMXLFRECHIPGQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |