C10H9BrN2S2 — CID 79399128
4-bromo-N-(3-methylsulfanylphenyl)-1,3-thiazol-2-amine (PubChem CID 79399128) has the molecular formula C10H9BrN2S2 and a molecular weight of 301.23 g/mol. Its IUPAC name is 4-bromo-N-(3-methylsulfanylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-bromo-N-(3-methylsulfanylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79399128 |
| Molecular Formula | C10H9BrN2S2 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 299.94 |
| IUPAC Name | 4-bromo-N-(3-methylsulfanylphenyl)-1,3-thiazol-2-amine |
| SMILES | CSc1cccc(Nc2nc(Br)cs2)c1 |
| InChI | InChI=1S/C10H9BrN2S2/c1-14-8-4-2-3-7(5-8)12-10-13-9(11)6-15-10/h2-6H,1H3,(H,12,13) |
| InChIKey | QQNQDTBHHNRBON-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |