C11H11BrN2O2S — CID 79400359
4-bromo-N-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 79400359) has the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. Its IUPAC name is 4-bromo-N-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-bromo-N-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79400359 |
| Molecular Formula | C11H11BrN2O2S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 4-bromo-N-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Nc2nc(Br)cs2)cc1OC |
| InChI | InChI=1S/C11H11BrN2O2S/c1-15-8-4-3-7(5-9(8)16-2)13-11-14-10(12)6-17-11/h3-6H,1-2H3,(H,13,14) |
| InChIKey | UIYACIVHAGOWEB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |