C21H26N2O2S — CID 118719853
4-(2-adamantyl)-N-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 118719853) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 4-(2-adamantyl)-N-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-adamantyl)-N-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 118719853 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-(2-adamantyl)-N-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Nc2nc(C3C4CC5CC(C4)CC3C5)cs2)cc1OC |
| InChI | InChI=1S/C21H26N2O2S/c1-24-18-4-3-16(10-19(18)25-2)22-21-23-17(11-26-21)20-14-6-12-5-13(8-14)9-15(20)7-12/h3-4,10-15,20H,5-9H2,1-2H3,(H,22,23) |
| InChIKey | UJALXDQUKUQEMV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |