C13H16N4O2 — CID 79823168
6-N-(3,4-dimethoxyphenyl)pyridine-2,3,6-triamine (PubChem CID 79823168) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 6-N-(3,4-dimethoxyphenyl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-(3,4-dimethoxyphenyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79823168 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 6-N-(3,4-dimethoxyphenyl)pyridine-2,3,6-triamine |
| SMILES | COc1ccc(Nc2ccc(N)c(N)n2)cc1OC |
| InChI | InChI=1S/C13H16N4O2/c1-18-10-5-3-8(7-11(10)19-2)16-12-6-4-9(14)13(15)17-12/h3-7H,14H2,1-2H3,(H3,15,16,17) |
| InChIKey | GICGYIKAGQYSGT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |