C15H18N2O2 — CID 62911783
1-N-(3,4-dimethoxyphenyl)-4-methylbenzene-1,3-diamine (PubChem CID 62911783) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-N-(3,4-dimethoxyphenyl)-4-methylbenzene-1,3-diamine.
| Compound Name | 1-N-(3,4-dimethoxyphenyl)-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 62911783 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-N-(3,4-dimethoxyphenyl)-4-methylbenzene-1,3-diamine |
| SMILES | COc1ccc(Nc2ccc(C)c(N)c2)cc1OC |
| InChI | InChI=1S/C15H18N2O2/c1-10-4-5-11(8-13(10)16)17-12-6-7-14(18-2)15(9-12)19-3/h4-9,17H,16H2,1-3H3 |
| InChIKey | KPTZSNIKFOSFEO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|