C8H12N2O — CID 87287100
1-N-methoxy-4-methylbenzene-1,3-diamine (PubChem CID 87287100) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-N-methoxy-4-methylbenzene-1,3-diamine.
| Compound Name | 1-N-methoxy-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 87287100 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1-N-methoxy-4-methylbenzene-1,3-diamine |
| SMILES | CONc1ccc(C)c(N)c1 |
| InChI | InChI=1S/C8H12N2O/c1-6-3-4-7(10-11-2)5-8(6)9/h3-5,10H,9H2,1-2H3 |
| InChIKey | CQQVWORERCDBRX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|