C13H25NO — CID 144566658
ethane;N-methoxy-3,4-dimethylaniline (PubChem CID 144566658) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;N-methoxy-3,4-dimethylaniline.
| Compound Name | ethane;N-methoxy-3,4-dimethylaniline |
|---|---|
| PubChem CID | 144566658 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;N-methoxy-3,4-dimethylaniline |
| SMILES | CC.CC.CONc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H13NO.2C2H6/c1-7-4-5-9(10-11-3)6-8(7)2;2*1-2/h4-6,10H,1-3H3;2*1-2H3 |
| InChIKey | VDXXODCVJVNODR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|