C22H26N2O4 — CID 71353836
dimethyl 2,3-bis(3,4-dimethylanilino)but-2-enedioate (PubChem CID 71353836) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is dimethyl 2,3-bis(3,4-dimethylanilino)but-2-enedioate.
| Compound Name | dimethyl 2,3-bis(3,4-dimethylanilino)but-2-enedioate |
|---|---|
| PubChem CID | 71353836 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | dimethyl 2,3-bis(3,4-dimethylanilino)but-2-enedioate |
| SMILES | COC(=O)C(Nc1ccc(C)c(C)c1)=C(Nc1ccc(C)c(C)c1)C(=O)OC |
| InChI | InChI=1S/C22H26N2O4/c1-13-7-9-17(11-15(13)3)23-19(21(25)27-5)20(22(26)28-6)24-18-10-8-14(2)16(4)12-18/h7-12,23-24H,1-6H3 |
| InChIKey | DWVBEMKSZHESOB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|