C13H23FN2 — CID 145194727
N'-(3,4-dimethylphenyl)-2-fluoropropane-1,3-diamine;ethane (PubChem CID 145194727) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is N'-(3,4-dimethylphenyl)-2-fluoropropane-1,3-diamine;ethane.
| Compound Name | N'-(3,4-dimethylphenyl)-2-fluoropropane-1,3-diamine;ethane |
|---|---|
| PubChem CID | 145194727 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | N'-(3,4-dimethylphenyl)-2-fluoropropane-1,3-diamine;ethane |
| SMILES | CC.Cc1ccc(NCC(F)CN)cc1C |
| InChI | InChI=1S/C11H17FN2.C2H6/c1-8-3-4-11(5-9(8)2)14-7-10(12)6-13;1-2/h3-5,10,14H,6-7,13H2,1-2H3;1-2H3 |
| InChIKey | PJMDBFKHAZOYNW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |