C12H20N2 — CID 83961425
1-N-(3,4-dimethylphenyl)butane-1,2-diamine (PubChem CID 83961425) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-N-(3,4-dimethylphenyl)butane-1,2-diamine.
| Compound Name | 1-N-(3,4-dimethylphenyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 83961425 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-N-(3,4-dimethylphenyl)butane-1,2-diamine |
| SMILES | CCC(N)CNc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H20N2/c1-4-11(13)8-14-12-6-5-9(2)10(3)7-12/h5-7,11,14H,4,8,13H2,1-3H3 |
| InChIKey | YINSIJUAHBTBTC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |