C10H15ClN2 — CID 83944476
1-N-(3-chlorophenyl)butane-1,2-diamine (PubChem CID 83944476) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is 1-N-(3-chlorophenyl)butane-1,2-diamine.
| Compound Name | 1-N-(3-chlorophenyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 83944476 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-N-(3-chlorophenyl)butane-1,2-diamine |
| SMILES | CCC(N)CNc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H15ClN2/c1-2-9(12)7-13-10-5-3-4-8(11)6-10/h3-6,9,13H,2,7,12H2,1H3 |
| InChIKey | WTNZZYFQWRMBTB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |