About 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine
1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine (PubChem CID 83951009) has the molecular formula C13H21ClN2
and a molecular weight of 240.78 g/mol. Its IUPAC name is 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine |
| PubChem CID | 83951009 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine |
| SMILES | CCCCC(N)CNc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C13H21ClN2/c1-3-4-5-11(15)9-16-12-7-6-10(2)13(14)8-12/h6-8,11,16H,3-5,9,15H2,1-2H3 |
| InChIKey | WAOKGWWTCKATCC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine?
The IUPAC name of 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine (CID 83951009) is 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine.
What is the SMILES notation for 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine?
The canonical SMILES for 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine is CCCCC(N)CNc1ccc(C)c(Cl)c1.
What is the InChIKey of 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine?
The InChIKey is WAOKGWWTCKATCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN2/c1-3-4-5-11(15)9-16-12-7-6-10(2)13(14)8-12/h6-8,11,16H,3-5,9,15H2,1-2H3.
What are the key properties of 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine?
1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine has a molecular weight of 240.78 g/mol, XLogP of 3.58, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(3-chloro-4-methylphenyl)hexane-1,2-diamine is sourced from PubChem (CID 83951009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).