C17H25ClN2O2 — CID 2291750
N'-(3-chloro-4-methylphenyl)-N-[(2S)-2-ethylhexyl]oxamide (PubChem CID 2291750) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is N'-(3-chloro-4-methylphenyl)-N-[(2S)-2-ethylhexyl]oxamide.
| Compound Name | N'-(3-chloro-4-methylphenyl)-N-[(2S)-2-ethylhexyl]oxamide |
|---|---|
| PubChem CID | 2291750 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N'-(3-chloro-4-methylphenyl)-N-[(2S)-2-ethylhexyl]oxamide |
| SMILES | CCCCC(CC)CNC(=O)C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C17H25ClN2O2/c1-4-6-7-13(5-2)11-19-16(21)17(22)20-14-9-8-12(3)15(18)10-14/h8-10,13H,4-7,11H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | XRILPSYFPJRDDG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|