C16H23FN2O2 — CID 2291432
N-[(2S)-2-ethylhexyl]-N'-(3-fluorophenyl)oxamide (PubChem CID 2291432) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is N-[(2S)-2-ethylhexyl]-N'-(3-fluorophenyl)oxamide.
| Compound Name | N-[(2S)-2-ethylhexyl]-N'-(3-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 2291432 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[(2S)-2-ethylhexyl]-N'-(3-fluorophenyl)oxamide |
| SMILES | CCCCC(CC)CNC(=O)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C16H23FN2O2/c1-3-5-7-12(4-2)11-18-15(20)16(21)19-14-9-6-8-13(17)10-14/h6,8-10,12H,3-5,7,11H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | YYJRXPYDJNYABG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|